C11H26ClN5O4 — CID 71530090
1,2-di(propan-2-yl)-3-(N'-propylcarbamimidoyl)guanidine;perchloric acid (PubChem CID 71530090) has the molecular formula C11H26ClN5O4 and a molecular weight of 327.81 g/mol. Its IUPAC name is 1,2-di(propan-2-yl)-3-(N'-propylcarbamimidoyl)guanidine;perchloric acid.
| Compound Name | 1,2-di(propan-2-yl)-3-(N'-propylcarbamimidoyl)guanidine;perchloric acid |
|---|---|
| PubChem CID | 71530090 |
| Molecular Formula | C11H26ClN5O4 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 1,2-di(propan-2-yl)-3-(N'-propylcarbamimidoyl)guanidine;perchloric acid |
| SMILES | CCC/N=C(\N)N/C(=N/C(C)C)NC(C)C.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C11H25N5.ClHO4/c1-6-7-13-10(12)16-11(14-8(2)3)15-9(4)5;2-1(3,4)5/h8-9H,6-7H2,1-5H3,(H4,12,13,14,15,16);(H,2,3,4,5) |
| InChIKey | IGUHQWHFHIGOLO-UHFFFAOYSA-N |
| XLogP | -3.06 |
| TPSA | 164.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|