C34H45NO7Si — CID 71530235
dimethyl (2S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-ethyl-2-[(4S,5R)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]cyclohex-3-ene-1,1-dicarboxylate (PubChem CID 71530235) has the molecular formula C34H45NO7Si and a molecular weight of 607.82 g/mol. Its IUPAC name is dimethyl (2S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-ethyl-2-[(4S,5R)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]cyclohex-3-ene-1,1-dicarboxylate.
| Compound Name | dimethyl (2S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-ethyl-2-[(4S,5R)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]cyclohex-3-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 71530235 |
| Molecular Formula | C34H45NO7Si |
| Molecular Weight | 607.82 g/mol |
| Exact Mass | 607.30 |
| IUPAC Name | dimethyl (2S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-ethyl-2-[(4S,5R)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]cyclohex-3-ene-1,1-dicarboxylate |
| SMILES | CCC1=C[C@@H](CO[Si](C)(C)C(C)(C)C)CC(C(=O)OC)(C(=O)OC)[C@H]1N1C(=O)O[C@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C34H45NO7Si/c1-9-24-20-23(22-41-43(7,8)33(2,3)4)21-34(30(36)39-5,31(37)40-6)29(24)35-27(25-16-12-10-13-17-25)28(42-32(35)38)26-18-14-11-15-19-26/h10-20,23,27-29H,9,21-22H2,1-8H3/t23-,27+,28-,29+/m1/s1 |
| InChIKey | XDIDXKZOUZDVOZ-LPWOILPXSA-N |
| XLogP | 7.00 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.82 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|