C13H21NO2Si — CID 71530350
3,3-dimethyl-7a-(2-trimethylsilylethynyl)-6,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 71530350) has the molecular formula C13H21NO2Si and a molecular weight of 251.40 g/mol. Its IUPAC name is 3,3-dimethyl-7a-(2-trimethylsilylethynyl)-6,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | 3,3-dimethyl-7a-(2-trimethylsilylethynyl)-6,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 71530350 |
| Molecular Formula | C13H21NO2Si |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 3,3-dimethyl-7a-(2-trimethylsilylethynyl)-6,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | CC1(C)OCC2(C#C[Si](C)(C)C)CCC(=O)N21 |
| InChI | InChI=1S/C13H21NO2Si/c1-12(2)14-11(15)6-7-13(14,10-16-12)8-9-17(3,4)5/h6-7,10H2,1-5H3 |
| InChIKey | BRZQOKNBJXFOBQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|