C19H17N3O — CID 71530691
1-[(N,4-dimethylanilino)methyl]-3-formylindole-6-carbonitrile (PubChem CID 71530691) has the molecular formula C19H17N3O and a molecular weight of 303.37 g/mol. Its IUPAC name is 1-[(N,4-dimethylanilino)methyl]-3-formylindole-6-carbonitrile.
| Compound Name | 1-[(N,4-dimethylanilino)methyl]-3-formylindole-6-carbonitrile |
|---|---|
| PubChem CID | 71530691 |
| Molecular Formula | C19H17N3O |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 1-[(N,4-dimethylanilino)methyl]-3-formylindole-6-carbonitrile |
| SMILES | Cc1ccc(N(C)Cn2cc(C=O)c3ccc(C#N)cc32)cc1 |
| InChI | InChI=1S/C19H17N3O/c1-14-3-6-17(7-4-14)21(2)13-22-11-16(12-23)18-8-5-15(10-20)9-19(18)22/h3-9,11-12H,13H2,1-2H3 |
| InChIKey | LVFQZMPDWNSIAQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 49.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|