About cyclohexylmethyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium
cyclohexylmethyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium (PubChem CID 7153079) has the molecular formula C10H19F3NO+
and a molecular weight of 226.26 g/mol. Its IUPAC name is cyclohexylmethyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium.
Molecular Properties
| Compound Name | cyclohexylmethyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium |
| PubChem CID | 7153079 |
| Molecular Formula | C10H19F3NO+ |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | cyclohexylmethyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium |
| SMILES | O[C@@H](C[NH2+]CC1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C10H18F3NO/c11-10(12,13)9(15)7-14-6-8-4-2-1-3-5-8/h8-9,14-15H,1-7H2/p+1/t9-/m0/s1 |
| InChIKey | KOAIXGJVLJRIMG-VIFPVBQESA-O |
| XLogP | 1.05 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclohexylmethyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylmethyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium?
The IUPAC name of cyclohexylmethyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium (CID 7153079) is cyclohexylmethyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium.
What is the SMILES notation for cyclohexylmethyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium?
The canonical SMILES for cyclohexylmethyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium is O[C@@H](C[NH2+]CC1CCCCC1)C(F)(F)F.
What is the InChIKey of cyclohexylmethyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium?
The InChIKey is KOAIXGJVLJRIMG-VIFPVBQESA-O. The full InChI is InChI=1S/C10H18F3NO/c11-10(12,13)9(15)7-14-6-8-4-2-1-3-5-8/h8-9,14-15H,1-7H2/p+1/t9-/m0/s1.
What are the key properties of cyclohexylmethyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium?
cyclohexylmethyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium has a molecular weight of 226.26 g/mol, XLogP of 1.05, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylmethyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium is sourced from PubChem (CID 7153079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).