About [(E)-(4-methylphenyl)methylideneamino] 4-methylpentanoate
[(E)-(4-methylphenyl)methylideneamino] 4-methylpentanoate (PubChem CID 71531006) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is [(E)-(4-methylphenyl)methylideneamino] 4-methylpentanoate.
Molecular Properties
| Compound Name | [(E)-(4-methylphenyl)methylideneamino] 4-methylpentanoate |
| PubChem CID | 71531006 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | [(E)-(4-methylphenyl)methylideneamino] 4-methylpentanoate |
| SMILES | Cc1ccc(/C=N/OC(=O)CCC(C)C)cc1 |
| InChI | InChI=1S/C14H19NO2/c1-11(2)4-9-14(16)17-15-10-13-7-5-12(3)6-8-13/h5-8,10-11H,4,9H2,1-3H3/b15-10+ |
| InChIKey | WTDJZEJOBOCZDZ-XNTDXEJSSA-N |
| XLogP | 3.31 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(4-methylphenyl)methylideneamino] 4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(4-methylphenyl)methylideneamino] 4-methylpentanoate?
The IUPAC name of [(E)-(4-methylphenyl)methylideneamino] 4-methylpentanoate (CID 71531006) is [(E)-(4-methylphenyl)methylideneamino] 4-methylpentanoate.
What is the SMILES notation for [(E)-(4-methylphenyl)methylideneamino] 4-methylpentanoate?
The canonical SMILES for [(E)-(4-methylphenyl)methylideneamino] 4-methylpentanoate is Cc1ccc(/C=N/OC(=O)CCC(C)C)cc1.
What is the InChIKey of [(E)-(4-methylphenyl)methylideneamino] 4-methylpentanoate?
The InChIKey is WTDJZEJOBOCZDZ-XNTDXEJSSA-N. The full InChI is InChI=1S/C14H19NO2/c1-11(2)4-9-14(16)17-15-10-13-7-5-12(3)6-8-13/h5-8,10-11H,4,9H2,1-3H3/b15-10+.
What are the key properties of [(E)-(4-methylphenyl)methylideneamino] 4-methylpentanoate?
[(E)-(4-methylphenyl)methylideneamino] 4-methylpentanoate has a molecular weight of 233.31 g/mol, XLogP of 3.31, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(4-methylphenyl)methylideneamino] 4-methylpentanoate is sourced from PubChem (CID 71531006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).