C20H34O4 — CID 71531070
2-hydroxy-2-[(2S,5S)-5-[(1E)-4-hydroxy-4-methylhexa-1,5-dienyl]-5-methyloxolan-2-yl]-6-methylheptan-4-one (PubChem CID 71531070) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is 2-hydroxy-2-[(2S,5S)-5-[(1E)-4-hydroxy-4-methylhexa-1,5-dienyl]-5-methyloxolan-2-yl]-6-methylheptan-4-one.
| Compound Name | 2-hydroxy-2-[(2S,5S)-5-[(1E)-4-hydroxy-4-methylhexa-1,5-dienyl]-5-methyloxolan-2-yl]-6-methylheptan-4-one |
|---|---|
| PubChem CID | 71531070 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 2-hydroxy-2-[(2S,5S)-5-[(1E)-4-hydroxy-4-methylhexa-1,5-dienyl]-5-methyloxolan-2-yl]-6-methylheptan-4-one |
| SMILES | C=CC(C)(O)C/C=C/[C@]1(C)CC[C@@H](C(C)(O)CC(=O)CC(C)C)O1 |
| InChI | InChI=1S/C20H34O4/c1-7-18(4,22)10-8-11-19(5)12-9-17(24-19)20(6,23)14-16(21)13-15(2)3/h7-8,11,15,17,22-23H,1,9-10,12-14H2,2-6H3/b11-8+/t17-,18?,19+,20?/m0/s1 |
| InChIKey | QETAPCQZVILDST-FTGFIKAVSA-N |
| XLogP | 3.56 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|