About 3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole
3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole (PubChem CID 71531121) has the molecular formula C10H10N2S
and a molecular weight of 190.27 g/mol. Its IUPAC name is 3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole.
Molecular Properties
| Compound Name | 3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole |
| PubChem CID | 71531121 |
| Molecular Formula | C10H10N2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole |
| SMILES | c1cc(-c2cnn3c2CCC3)cs1 |
| InChI | InChI=1S/C10H10N2S/c1-2-10-9(6-11-12(10)4-1)8-3-5-13-7-8/h3,5-7H,1-2,4H2 |
| InChIKey | GSHFPMPRSKGZSF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole?
The IUPAC name of 3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole (CID 71531121) is 3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole.
What is the SMILES notation for 3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole?
The canonical SMILES for 3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole is c1cc(-c2cnn3c2CCC3)cs1.
What is the InChIKey of 3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole?
The InChIKey is GSHFPMPRSKGZSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2S/c1-2-10-9(6-11-12(10)4-1)8-3-5-13-7-8/h3,5-7H,1-2,4H2.
What are the key properties of 3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole?
3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole has a molecular weight of 190.27 g/mol, XLogP of 2.56, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole is sourced from PubChem (CID 71531121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).