C22H40O5Si — CID 71531437
[(2R,4E)-6-[tert-butyl(dimethyl)silyl]oxynona-4,8-dien-2-yl] (3R)-3-(methoxymethoxy)pent-4-enoate (PubChem CID 71531437) has the molecular formula C22H40O5Si and a molecular weight of 412.64 g/mol. Its IUPAC name is [(2R,4E)-6-[tert-butyl(dimethyl)silyl]oxynona-4,8-dien-2-yl] (3R)-3-(methoxymethoxy)pent-4-enoate.
| Compound Name | [(2R,4E)-6-[tert-butyl(dimethyl)silyl]oxynona-4,8-dien-2-yl] (3R)-3-(methoxymethoxy)pent-4-enoate |
|---|---|
| PubChem CID | 71531437 |
| Molecular Formula | C22H40O5Si |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | [(2R,4E)-6-[tert-butyl(dimethyl)silyl]oxynona-4,8-dien-2-yl] (3R)-3-(methoxymethoxy)pent-4-enoate |
| SMILES | C=CCC(/C=C/C[C@@H](C)OC(=O)C[C@H](C=C)OCOC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40O5Si/c1-10-13-20(27-28(8,9)22(4,5)6)15-12-14-18(3)26-21(23)16-19(11-2)25-17-24-7/h10-12,15,18-20H,1-2,13-14,16-17H2,3-9H3/b15-12+/t18-,19+,20?/m1/s1 |
| InChIKey | HGMZFHSJMAXCGJ-NKVZCSLSSA-N |
| XLogP | 5.40 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|