C20H36O5Si — CID 71531555
(4R,5Z,9E,12R)-8-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-12-methyl-1-oxacyclododeca-5,9-dien-2-one (PubChem CID 71531555) has the molecular formula C20H36O5Si and a molecular weight of 384.59 g/mol. Its IUPAC name is (4R,5Z,9E,12R)-8-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-12-methyl-1-oxacyclododeca-5,9-dien-2-one.
| Compound Name | (4R,5Z,9E,12R)-8-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-12-methyl-1-oxacyclododeca-5,9-dien-2-one |
|---|---|
| PubChem CID | 71531555 |
| Molecular Formula | C20H36O5Si |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | (4R,5Z,9E,12R)-8-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-12-methyl-1-oxacyclododeca-5,9-dien-2-one |
| SMILES | COCO[C@H]1/C=C\CC(O[Si](C)(C)C(C)(C)C)/C=C/C[C@@H](C)OC(=O)C1 |
| InChI | InChI=1S/C20H36O5Si/c1-16-10-8-11-17(25-26(6,7)20(2,3)4)12-9-13-18(23-15-22-5)14-19(21)24-16/h8-9,11,13,16-18H,10,12,14-15H2,1-7H3/b11-8+,13-9-/t16-,17?,18+/m1/s1 |
| InChIKey | CQVBFIYVYIYERX-HTVLXLBKSA-N |
| XLogP | 4.59 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|