About 5-(aminomethyl)-1,3-dimethylpyridin-2-one
5-(aminomethyl)-1,3-dimethylpyridin-2-one (PubChem CID 71531830) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 5-(aminomethyl)-1,3-dimethylpyridin-2-one.
Molecular Properties
| Compound Name | 5-(aminomethyl)-1,3-dimethylpyridin-2-one |
| PubChem CID | 71531830 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 5-(aminomethyl)-1,3-dimethylpyridin-2-one |
| SMILES | Cc1cc(CN)cn(C)c1=O |
| InChI | InChI=1S/C8H12N2O/c1-6-3-7(4-9)5-10(2)8(6)11/h3,5H,4,9H2,1-2H3 |
| InChIKey | GSUWMEBAUUPOMC-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(aminomethyl)-1,3-dimethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-1,3-dimethylpyridin-2-one?
The IUPAC name of 5-(aminomethyl)-1,3-dimethylpyridin-2-one (CID 71531830) is 5-(aminomethyl)-1,3-dimethylpyridin-2-one.
What is the SMILES notation for 5-(aminomethyl)-1,3-dimethylpyridin-2-one?
The canonical SMILES for 5-(aminomethyl)-1,3-dimethylpyridin-2-one is Cc1cc(CN)cn(C)c1=O.
What is the InChIKey of 5-(aminomethyl)-1,3-dimethylpyridin-2-one?
The InChIKey is GSUWMEBAUUPOMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-6-3-7(4-9)5-10(2)8(6)11/h3,5H,4,9H2,1-2H3.
What are the key properties of 5-(aminomethyl)-1,3-dimethylpyridin-2-one?
5-(aminomethyl)-1,3-dimethylpyridin-2-one has a molecular weight of 152.20 g/mol, XLogP of 0.15, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-1,3-dimethylpyridin-2-one is sourced from PubChem (CID 71531830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).