C18H21N5 — CID 71532617
1-cyano-2-propyl-3-(1,2,3,4-tetrahydroacridin-9-yl)guanidine (PubChem CID 71532617) has the molecular formula C18H21N5 and a molecular weight of 307.40 g/mol. Its IUPAC name is 1-cyano-2-propyl-3-(1,2,3,4-tetrahydroacridin-9-yl)guanidine.
| Compound Name | 1-cyano-2-propyl-3-(1,2,3,4-tetrahydroacridin-9-yl)guanidine |
|---|---|
| PubChem CID | 71532617 |
| Molecular Formula | C18H21N5 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 1-cyano-2-propyl-3-(1,2,3,4-tetrahydroacridin-9-yl)guanidine |
| SMILES | CCC/N=C(\NC#N)Nc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C18H21N5/c1-2-11-20-18(21-12-19)23-17-13-7-3-5-9-15(13)22-16-10-6-4-8-14(16)17/h3,5,7,9H,2,4,6,8,10-11H2,1H3,(H2,20,21,22,23) |
| InChIKey | BQKAZJQKCOOPOX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|