C29H26N6O — CID 71533111
7-(1,4,5,6-tetrahydropyrimidin-2-yl)-2-[4-[2-(1,4,5,6-tetrahydropyrimidin-2-yl)-1-benzofuran-6-yl]phenyl]imidazo[1,2-a]pyridine (PubChem CID 71533111) has the molecular formula C29H26N6O and a molecular weight of 474.57 g/mol. Its IUPAC name is 7-(1,4,5,6-tetrahydropyrimidin-2-yl)-2-[4-[2-(1,4,5,6-tetrahydropyrimidin-2-yl)-1-benzofuran-6-yl]phenyl]imidazo[1,2-a]pyridine.
| Compound Name | 7-(1,4,5,6-tetrahydropyrimidin-2-yl)-2-[4-[2-(1,4,5,6-tetrahydropyrimidin-2-yl)-1-benzofuran-6-yl]phenyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 71533111 |
| Molecular Formula | C29H26N6O |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 7-(1,4,5,6-tetrahydropyrimidin-2-yl)-2-[4-[2-(1,4,5,6-tetrahydropyrimidin-2-yl)-1-benzofuran-6-yl]phenyl]imidazo[1,2-a]pyridine |
| SMILES | c1cn2cc(-c3ccc(-c4ccc5cc(C6=NCCCN6)oc5c4)cc3)nc2cc1C1=NCCCN1 |
| InChI | InChI=1S/C29H26N6O/c1-10-30-28(31-11-1)23-9-14-35-18-24(34-27(35)17-23)20-5-3-19(4-6-20)21-7-8-22-16-26(36-25(22)15-21)29-32-12-2-13-33-29/h3-9,14-18H,1-2,10-13H2,(H,30,31)(H,32,33) |
| InChIKey | ILXAUIPUBCLCOW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 79.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |