C32H42N4O5S — CID 71533701
S-[(E)-4-[(9S,12S)-7,10,14-trioxo-9-propan-2-yl-11-oxa-8,15,21,22-tetrazatricyclo[15.3.1.12,6]docosa-1(20),2(22),3,5,17(21),18-hexaen-12-yl]but-3-enyl] octanethioate (PubChem CID 71533701) has the molecular formula C32H42N4O5S and a molecular weight of 594.78 g/mol. Its IUPAC name is S-[(E)-4-[(9S,12S)-7,10,14-trioxo-9-propan-2-yl-11-oxa-8,15,21,22-tetrazatricyclo[15.3.1.12,6]docosa-1(20),2(22),3,5,17(21),18-hexaen-12-yl]but-3-enyl] octanethioate.
| Compound Name | S-[(E)-4-[(9S,12S)-7,10,14-trioxo-9-propan-2-yl-11-oxa-8,15,21,22-tetrazatricyclo[15.3.1.12,6]docosa-1(20),2(22),3,5,17(21),18-hexaen-12-yl]but-3-enyl] octanethioate |
|---|---|
| PubChem CID | 71533701 |
| Molecular Formula | C32H42N4O5S |
| Molecular Weight | 594.78 g/mol |
| Exact Mass | 594.29 |
| IUPAC Name | S-[(E)-4-[(9S,12S)-7,10,14-trioxo-9-propan-2-yl-11-oxa-8,15,21,22-tetrazatricyclo[15.3.1.12,6]docosa-1(20),2(22),3,5,17(21),18-hexaen-12-yl]but-3-enyl] octanethioate |
| SMILES | CCCCCCCC(=O)SCC/C=C/[C@@H]1CC(=O)NCc2cccc(n2)-c2cccc(n2)C(=O)N[C@@H](C(C)C)C(=O)O1 |
| InChI | InChI=1S/C32H42N4O5S/c1-4-5-6-7-8-18-29(38)42-19-10-9-14-24-20-28(37)33-21-23-13-11-15-25(34-23)26-16-12-17-27(35-26)31(39)36-30(22(2)3)32(40)41-24/h9,11-17,22,24,30H,4-8,10,18-21H2,1-3H3,(H,33,37)(H,36,39)/b14-9+/t24-,30+/m1/s1 |
| InChIKey | KLHJYHRTDPBXQV-KBKLQMCYSA-N |
| XLogP | 5.40 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.78 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|