C23H21N5O — CID 71533939
2-[4-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)phenoxy]-N,N-dimethylethanamine (PubChem CID 71533939) has the molecular formula C23H21N5O and a molecular weight of 383.46 g/mol. Its IUPAC name is 2-[4-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)phenoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[4-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)phenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 71533939 |
| Molecular Formula | C23H21N5O |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 2-[4-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)phenoxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1ccc(-c2nc3c4cccnc4c4ncccc4c3[nH]2)cc1 |
| InChI | InChI=1S/C23H21N5O/c1-28(2)13-14-29-16-9-7-15(8-10-16)23-26-21-17-5-3-11-24-19(17)20-18(22(21)27-23)6-4-12-25-20/h3-12H,13-14H2,1-2H3,(H,26,27) |
| InChIKey | URWZUTJTTPSBIS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|