C18H18F3NO2S — CID 71534068
(2S,4R)-4-(benzenesulfonyl)-1-benzyl-2-(trifluoromethyl)pyrrolidine (PubChem CID 71534068) has the molecular formula C18H18F3NO2S and a molecular weight of 369.41 g/mol. Its IUPAC name is (2S,4R)-4-(benzenesulfonyl)-1-benzyl-2-(trifluoromethyl)pyrrolidine.
| Compound Name | (2S,4R)-4-(benzenesulfonyl)-1-benzyl-2-(trifluoromethyl)pyrrolidine |
|---|---|
| PubChem CID | 71534068 |
| Molecular Formula | C18H18F3NO2S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | (2S,4R)-4-(benzenesulfonyl)-1-benzyl-2-(trifluoromethyl)pyrrolidine |
| SMILES | O=S(=O)(c1ccccc1)[C@@H]1C[C@@H](C(F)(F)F)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H18F3NO2S/c19-18(20,21)17-11-16(25(23,24)15-9-5-2-6-10-15)13-22(17)12-14-7-3-1-4-8-14/h1-10,16-17H,11-13H2/t16-,17+/m1/s1 |
| InChIKey | QNQSGTRUFFSOCL-SJORKVTESA-N |
| XLogP | 3.67 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |