C16H24O3 — CID 71534406
(4R)-2,2-dimethyl-4-[(2S)-4-phenylmethoxybutan-2-yl]-1,3-dioxolane (PubChem CID 71534406) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (4R)-2,2-dimethyl-4-[(2S)-4-phenylmethoxybutan-2-yl]-1,3-dioxolane.
| Compound Name | (4R)-2,2-dimethyl-4-[(2S)-4-phenylmethoxybutan-2-yl]-1,3-dioxolane |
|---|---|
| PubChem CID | 71534406 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (4R)-2,2-dimethyl-4-[(2S)-4-phenylmethoxybutan-2-yl]-1,3-dioxolane |
| SMILES | C[C@@H](CCOCc1ccccc1)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C16H24O3/c1-13(15-12-18-16(2,3)19-15)9-10-17-11-14-7-5-4-6-8-14/h4-8,13,15H,9-12H2,1-3H3/t13-,15-/m0/s1 |
| InChIKey | KOEBRZBMOZMVBE-ZFWWWQNUSA-N |
| XLogP | 3.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|