C20H29N3O3S — CID 71534810
(2S)-N-[(2S)-1-(4-methylanilino)-1-oxo-7-sulfanylheptan-2-yl]-6-oxopiperidine-2-carboxamide (PubChem CID 71534810) has the molecular formula C20H29N3O3S and a molecular weight of 391.50 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-(4-methylanilino)-1-oxo-7-sulfanylheptan-2-yl]-6-oxopiperidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S)-1-(4-methylanilino)-1-oxo-7-sulfanylheptan-2-yl]-6-oxopiperidine-2-carboxamide |
|---|---|
| PubChem CID | 71534810 |
| Molecular Formula | C20H29N3O3S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | (2S)-N-[(2S)-1-(4-methylanilino)-1-oxo-7-sulfanylheptan-2-yl]-6-oxopiperidine-2-carboxamide |
| SMILES | CC1=CC=C(C=C1)NC(=O)[C@H](CCCCCS)NC(=O)[C@@H]2CCCC(=O)N2 |
| InChI | InChI=1S/C20H29N3O3S/c1-14-9-11-15(12-10-14)21-19(25)17(6-3-2-4-13-27)23-20(26)16-7-5-8-18(24)22-16/h9-12,16-17,27H,2-8,13H2,1H3,(H,21,25)(H,22,24)(H,23,26)/t16-,17-/m0/s1 |
| InChIKey | PVOSRCQGYUSIRG-IRXDYDNUSA-N |
| XLogP | 2.40 |
| TPSA | 88.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | 507 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|