C30H20Cl2N2O3S — CID 71534958
2-[4-(benzylcarbamoyl)phenyl]-5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]benzoic acid (PubChem CID 71534958) has the molecular formula C30H20Cl2N2O3S and a molecular weight of 559.47 g/mol. Its IUPAC name is 2-[4-(benzylcarbamoyl)phenyl]-5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]benzoic acid.
| Compound Name | 2-[4-(benzylcarbamoyl)phenyl]-5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 71534958 |
| Molecular Formula | C30H20Cl2N2O3S |
| Molecular Weight | 559.47 g/mol |
| Exact Mass | 558.06 |
| IUPAC Name | 2-[4-(benzylcarbamoyl)phenyl]-5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]benzoic acid |
| SMILES | O=C(NCc1ccccc1)c1ccc(-c2ccc(-c3nc(-c4ccc(Cl)c(Cl)c4)cs3)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C30H20Cl2N2O3S/c31-25-13-11-21(15-26(25)32)27-17-38-29(34-27)22-10-12-23(24(14-22)30(36)37)19-6-8-20(9-7-19)28(35)33-16-18-4-2-1-3-5-18/h1-15,17H,16H2,(H,33,35)(H,36,37) |
| InChIKey | OEOMDVPDDSABLE-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.47 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |