C14H12N2O3 — CID 71535148
3-benzoyl-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2,4-dione (PubChem CID 71535148) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 3-benzoyl-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2,4-dione.
| Compound Name | 3-benzoyl-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 71535148 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 3-benzoyl-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2,4-dione |
| SMILES | O=C(c1ccccc1)n1c(=O)[nH]c2c(c1=O)CCC2 |
| InChI | InChI=1S/C14H12N2O3/c17-12(9-5-2-1-3-6-9)16-13(18)10-7-4-8-11(10)15-14(16)19/h1-3,5-6H,4,7-8H2,(H,15,19) |
| InChIKey | IHFVPLOCBWIKEG-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |