C19H26O5 — CID 71535163
(3E,6S,9E,11Z,15E)-6-(hydroxymethyl)-4,12-dimethyl-1,7-dioxacyclooctadeca-3,9,11,15-tetraene-8,14-dione (PubChem CID 71535163) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is (3E,6S,9E,11Z,15E)-6-(hydroxymethyl)-4,12-dimethyl-1,7-dioxacyclooctadeca-3,9,11,15-tetraene-8,14-dione.
| Compound Name | (3E,6S,9E,11Z,15E)-6-(hydroxymethyl)-4,12-dimethyl-1,7-dioxacyclooctadeca-3,9,11,15-tetraene-8,14-dione |
|---|---|
| PubChem CID | 71535163 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (3E,6S,9E,11Z,15E)-6-(hydroxymethyl)-4,12-dimethyl-1,7-dioxacyclooctadeca-3,9,11,15-tetraene-8,14-dione |
| SMILES | C/C1=C/C=C/C(=O)O[C@H](CO)C/C(C)=C/COCC/C=C/C(=O)C1 |
| InChI | InChI=1S/C19H26O5/c1-15-6-5-8-19(22)24-18(14-20)13-16(2)9-11-23-10-4-3-7-17(21)12-15/h3,5-9,18,20H,4,10-14H2,1-2H3/b7-3+,8-5+,15-6-,16-9+/t18-/m0/s1 |
| InChIKey | YTFKFQFHJMQMRW-PQFDZAQDSA-N |
| XLogP | 2.67 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|