C19H24O5 — CID 71535164
(2S,4E,10E,14Z,16E)-4,14-dimethyl-12,18-dioxo-1,7-dioxacyclooctadeca-4,10,14,16-tetraene-2-carbaldehyde (PubChem CID 71535164) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is (2S,4E,10E,14Z,16E)-4,14-dimethyl-12,18-dioxo-1,7-dioxacyclooctadeca-4,10,14,16-tetraene-2-carbaldehyde.
| Compound Name | (2S,4E,10E,14Z,16E)-4,14-dimethyl-12,18-dioxo-1,7-dioxacyclooctadeca-4,10,14,16-tetraene-2-carbaldehyde |
|---|---|
| PubChem CID | 71535164 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (2S,4E,10E,14Z,16E)-4,14-dimethyl-12,18-dioxo-1,7-dioxacyclooctadeca-4,10,14,16-tetraene-2-carbaldehyde |
| SMILES | C/C1=C/C=C/C(=O)O[C@H](C=O)C/C(C)=C/COCC/C=C/C(=O)C1 |
| InChI | InChI=1S/C19H24O5/c1-15-6-5-8-19(22)24-18(14-20)13-16(2)9-11-23-10-4-3-7-17(21)12-15/h3,5-9,14,18H,4,10-13H2,1-2H3/b7-3+,8-5+,15-6-,16-9+/t18-/m0/s1 |
| InChIKey | MRUJZAMNHYIFBS-PQFDZAQDSA-N |
| XLogP | 2.87 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|