C28H32F3N7O3 — CID 71535671
20,20-dimethyl-16-methylidene-5-(2,2,2-trifluoroethoxy)-14-oxa-2,4,6,8,18,22,26-heptazatetracyclo[22.2.2.210,13.13,7]hentriaconta-1(26),3,5,7(31),10(30),11,13(29),24,27-nonaen-23-one (PubChem CID 71535671) has the molecular formula C28H32F3N7O3 and a molecular weight of 571.60 g/mol. Its IUPAC name is 20,20-dimethyl-16-methylidene-5-(2,2,2-trifluoroethoxy)-14-oxa-2,4,6,8,18,22,26-heptazatetracyclo[22.2.2.210,13.13,7]hentriaconta-1(26),3,5,7(31),10(30),11,13(29),24,27-nonaen-23-one.
| Compound Name | 20,20-dimethyl-16-methylidene-5-(2,2,2-trifluoroethoxy)-14-oxa-2,4,6,8,18,22,26-heptazatetracyclo[22.2.2.210,13.13,7]hentriaconta-1(26),3,5,7(31),10(30),11,13(29),24,27-nonaen-23-one |
|---|---|
| PubChem CID | 71535671 |
| Molecular Formula | C28H32F3N7O3 |
| Molecular Weight | 571.60 g/mol |
| Exact Mass | 571.25 |
| IUPAC Name | 20,20-dimethyl-16-methylidene-5-(2,2,2-trifluoroethoxy)-14-oxa-2,4,6,8,18,22,26-heptazatetracyclo[22.2.2.210,13.13,7]hentriaconta-1(26),3,5,7(31),10(30),11,13(29),24,27-nonaen-23-one |
| SMILES | C=C1CNCC(C)(C)CNC(=O)c2ccc(nc2)Nc2cc(nc(OCC(F)(F)F)n2)NCc2ccc(cc2)OC1 |
| InChI | InChI=1S/C28H32F3N7O3/c1-18-11-32-15-27(2,3)16-35-25(39)20-6-9-22(34-13-20)36-24-10-23(37-26(38-24)41-17-28(29,30)31)33-12-19-4-7-21(8-5-19)40-14-18/h4-10,13,32H,1,11-12,14-17H2,2-3H3,(H,35,39)(H2,33,34,36,37,38) |
| InChIKey | NCFJZRJRTXGHDK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.60 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|