C29H34N4O9 — CID 71535754
dimethyl (1R,5S)-3,7-bis(2-ethoxy-2-oxoethyl)-9-oxo-2,4-dipyridin-2-yl-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate (PubChem CID 71535754) has the molecular formula C29H34N4O9 and a molecular weight of 582.61 g/mol. Its IUPAC name is dimethyl (1R,5S)-3,7-bis(2-ethoxy-2-oxoethyl)-9-oxo-2,4-dipyridin-2-yl-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate.
| Compound Name | dimethyl (1R,5S)-3,7-bis(2-ethoxy-2-oxoethyl)-9-oxo-2,4-dipyridin-2-yl-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate |
|---|---|
| PubChem CID | 71535754 |
| Molecular Formula | C29H34N4O9 |
| Molecular Weight | 582.61 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | dimethyl (1R,5S)-3,7-bis(2-ethoxy-2-oxoethyl)-9-oxo-2,4-dipyridin-2-yl-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate |
| SMILES | CCOC(=O)CN1C[C@]2(C(=O)OC)C(=O)[C@](C(=O)OC)(C1)C(c1ccccn1)N(CC(=O)OCC)C2c1ccccn1 |
| InChI | InChI=1S/C29H34N4O9/c1-5-41-21(34)15-32-17-28(26(37)39-3)23(19-11-7-9-13-30-19)33(16-22(35)42-6-2)24(20-12-8-10-14-31-20)29(18-32,25(28)36)27(38)40-4/h7-14,23-24H,5-6,15-18H2,1-4H3/t23?,24?,28-,29+ |
| InChIKey | LFCPTUZQZJNKMF-LXCDNTOHSA-N |
| XLogP | 0.90 |
| TPSA | 154.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.61 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|