C13H20N2O2 — CID 71535804
(1R,2R,3S,5R,6S,7S,8S,9R,10S,11R)-8,11-bis(aminomethyl)pentacyclo[5.4.0.02,6.03,10.05,9]undecane-8,11-diol (PubChem CID 71535804) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is (1R,2R,3S,5R,6S,7S,8S,9R,10S,11R)-8,11-bis(aminomethyl)pentacyclo[5.4.0.02,6.03,10.05,9]undecane-8,11-diol.
| Compound Name | (1R,2R,3S,5R,6S,7S,8S,9R,10S,11R)-8,11-bis(aminomethyl)pentacyclo[5.4.0.02,6.03,10.05,9]undecane-8,11-diol |
|---|---|
| PubChem CID | 71535804 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | (1R,2R,3S,5R,6S,7S,8S,9R,10S,11R)-8,11-bis(aminomethyl)pentacyclo[5.4.0.02,6.03,10.05,9]undecane-8,11-diol |
| SMILES | NC[C@]1(O)[C@@H]2[C@@H]3[C@@H]4C[C@@H]5[C@@H]3[C@@H]2[C@](O)(CN)[C@H]5[C@H]41 |
| InChI | InChI=1S/C13H20N2O2/c14-2-12(16)8-4-1-5-7-6(4)10(12)11(7)13(17,3-15)9(5)8/h4-11,16-17H,1-3,14-15H2/t4-,5+,6+,7-,8-,9+,10+,11-,12+,13- |
| InChIKey | DWGBTUCJQQAMSX-HOHHCJSRSA-N |
| XLogP | -1.25 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |