C35H50O7Si — CID 71536026
(2S,4aS,6R,7S,8aR)-2-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]-7-phenylmethoxy-6-(phenylmethoxymethyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-3-one (PubChem CID 71536026) has the molecular formula C35H50O7Si and a molecular weight of 610.86 g/mol. Its IUPAC name is (2S,4aS,6R,7S,8aR)-2-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]-7-phenylmethoxy-6-(phenylmethoxymethyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-3-one.
| Compound Name | (2S,4aS,6R,7S,8aR)-2-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]-7-phenylmethoxy-6-(phenylmethoxymethyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-3-one |
|---|---|
| PubChem CID | 71536026 |
| Molecular Formula | C35H50O7Si |
| Molecular Weight | 610.86 g/mol |
| Exact Mass | 610.33 |
| IUPAC Name | (2S,4aS,6R,7S,8aR)-2-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]-7-phenylmethoxy-6-(phenylmethoxymethyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCCO[C@@H]1C[C@@H]1O[C@@H]2C[C@H](OCc3ccccc3)[C@@H](COCc3ccccc3)O[C@H]2CC1=O |
| InChI | InChI=1S/C35H50O7Si/c1-35(2,3)43(4,5)42-28-17-12-18-38-30(28)20-29-27(36)19-32-33(40-29)21-31(39-23-26-15-10-7-11-16-26)34(41-32)24-37-22-25-13-8-6-9-14-25/h6-11,13-16,28-34H,12,17-24H2,1-5H3/t28-,29-,30+,31-,32-,33+,34+/m0/s1 |
| InChIKey | QVYXDVRFNBCENK-VUQRSNILSA-N |
| XLogP | 6.63 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.86 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|