About (1E)-1-diphenylphosphoryl-3-methyl-2-methylsulfanylpenta-1,4-dien-3-ol
(1E)-1-diphenylphosphoryl-3-methyl-2-methylsulfanylpenta-1,4-dien-3-ol (PubChem CID 71536584) has the molecular formula C19H21O2PS
and a molecular weight of 344.42 g/mol. Its IUPAC name is (1E)-1-diphenylphosphoryl-3-methyl-2-methylsulfanylpenta-1,4-dien-3-ol.
Molecular Properties
| Compound Name | (1E)-1-diphenylphosphoryl-3-methyl-2-methylsulfanylpenta-1,4-dien-3-ol |
| PubChem CID | 71536584 |
| Molecular Formula | C19H21O2PS |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | (1E)-1-diphenylphosphoryl-3-methyl-2-methylsulfanylpenta-1,4-dien-3-ol |
| SMILES | C=CC(C)(O)/C(=C\P(=O)(c1ccccc1)c1ccccc1)SC |
| InChI | InChI=1S/C19H21O2PS/c1-4-19(2,20)18(23-3)15-22(21,16-11-7-5-8-12-16)17-13-9-6-10-14-17/h4-15,20H,1H2,2-3H3/b18-15+ |
| InChIKey | UTYWBAKMZZJSNS-OBGWFSINSA-N |
| XLogP | 4.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-diphenylphosphoryl-3-methyl-2-methylsulfanylpenta-1,4-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-diphenylphosphoryl-3-methyl-2-methylsulfanylpenta-1,4-dien-3-ol?
The IUPAC name of (1E)-1-diphenylphosphoryl-3-methyl-2-methylsulfanylpenta-1,4-dien-3-ol (CID 71536584) is (1E)-1-diphenylphosphoryl-3-methyl-2-methylsulfanylpenta-1,4-dien-3-ol.
What is the SMILES notation for (1E)-1-diphenylphosphoryl-3-methyl-2-methylsulfanylpenta-1,4-dien-3-ol?
The canonical SMILES for (1E)-1-diphenylphosphoryl-3-methyl-2-methylsulfanylpenta-1,4-dien-3-ol is C=CC(C)(O)/C(=C\P(=O)(c1ccccc1)c1ccccc1)SC.
What is the InChIKey of (1E)-1-diphenylphosphoryl-3-methyl-2-methylsulfanylpenta-1,4-dien-3-ol?
The InChIKey is UTYWBAKMZZJSNS-OBGWFSINSA-N. The full InChI is InChI=1S/C19H21O2PS/c1-4-19(2,20)18(23-3)15-22(21,16-11-7-5-8-12-16)17-13-9-6-10-14-17/h4-15,20H,1H2,2-3H3/b18-15+.
What are the key properties of (1E)-1-diphenylphosphoryl-3-methyl-2-methylsulfanylpenta-1,4-dien-3-ol?
(1E)-1-diphenylphosphoryl-3-methyl-2-methylsulfanylpenta-1,4-dien-3-ol has a molecular weight of 344.42 g/mol, XLogP of 4.14, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-diphenylphosphoryl-3-methyl-2-methylsulfanylpenta-1,4-dien-3-ol is sourced from PubChem (CID 71536584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).