C21H27N5O5 — CID 71536748
oxalic acid;2-(2-piperidin-1-ylethyl)-5-(1-propan-2-ylindazol-3-yl)-1,3,4-oxadiazole (PubChem CID 71536748) has the molecular formula C21H27N5O5 and a molecular weight of 429.48 g/mol. Its IUPAC name is oxalic acid;2-(2-piperidin-1-ylethyl)-5-(1-propan-2-ylindazol-3-yl)-1,3,4-oxadiazole.
| Compound Name | oxalic acid;2-(2-piperidin-1-ylethyl)-5-(1-propan-2-ylindazol-3-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 71536748 |
| Molecular Formula | C21H27N5O5 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | oxalic acid;2-(2-piperidin-1-ylethyl)-5-(1-propan-2-ylindazol-3-yl)-1,3,4-oxadiazole |
| SMILES | CC(C)n1nc(-c2nnc(CCN3CCCCC3)o2)c2ccccc21.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H25N5O.C2H2O4/c1-14(2)24-16-9-5-4-8-15(16)18(22-24)19-21-20-17(25-19)10-13-23-11-6-3-7-12-23;3-1(4)2(5)6/h4-5,8-9,14H,3,6-7,10-13H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | YDQDIKYQYPYXMY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 134.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|