C22H32FNO7P2 — CID 71536888
[2-(3,5-ditert-butyl-2-hydroxyanilino)-2-(4-fluorophenyl)-1-phosphonoethyl]phosphonic acid (PubChem CID 71536888) has the molecular formula C22H32FNO7P2 and a molecular weight of 503.44 g/mol. Its IUPAC name is [2-(3,5-ditert-butyl-2-hydroxyanilino)-2-(4-fluorophenyl)-1-phosphonoethyl]phosphonic acid.
| Compound Name | [2-(3,5-ditert-butyl-2-hydroxyanilino)-2-(4-fluorophenyl)-1-phosphonoethyl]phosphonic acid |
|---|---|
| PubChem CID | 71536888 |
| Molecular Formula | C22H32FNO7P2 |
| Molecular Weight | 503.44 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | [2-(3,5-ditert-butyl-2-hydroxyanilino)-2-(4-fluorophenyl)-1-phosphonoethyl]phosphonic acid |
| SMILES | CC(C)(C)c1cc(NC(c2ccc(F)cc2)C(P(=O)(O)O)P(=O)(O)O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H32FNO7P2/c1-21(2,3)14-11-16(22(4,5)6)19(25)17(12-14)24-18(13-7-9-15(23)10-8-13)20(32(26,27)28)33(29,30)31/h7-12,18,20,24-25H,1-6H3,(H2,26,27,28)(H2,29,30,31) |
| InChIKey | ICEJMUNNXKJVAF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.44 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|