C24H29N3O3S — CID 71537641
(3S,4R)-N-[(2S)-1-anilino-1-oxo-7-sulfanylheptan-2-yl]-2-oxo-4-phenylpyrrolidine-3-carboxamide (PubChem CID 71537641) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is (3S,4R)-N-[(2S)-1-anilino-1-oxo-7-sulfanylheptan-2-yl]-2-oxo-4-phenylpyrrolidine-3-carboxamide.
| Compound Name | (3S,4R)-N-[(2S)-1-anilino-1-oxo-7-sulfanylheptan-2-yl]-2-oxo-4-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 71537641 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | (3S,4R)-N-[(2S)-1-anilino-1-oxo-7-sulfanylheptan-2-yl]-2-oxo-4-phenylpyrrolidine-3-carboxamide |
| SMILES | O=C1NC[C@@H](c2ccccc2)[C@@H]1C(=O)N[C@@H](CCCCCS)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C24H29N3O3S/c28-22(26-18-12-6-2-7-13-18)20(14-8-3-9-15-31)27-24(30)21-19(16-25-23(21)29)17-10-4-1-5-11-17/h1-2,4-7,10-13,19-21,31H,3,8-9,14-16H2,(H,25,29)(H,26,28)(H,27,30)/t19-,20-,21-/m0/s1 |
| InChIKey | UHKDIMIVZUCWEH-ACRUOGEOSA-N |
| XLogP | 3.13 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|