C18H22F3NO4 — CID 71537688
diethyl (2S,3R,4R)-1-benzyl-2-(trifluoromethyl)pyrrolidine-3,4-dicarboxylate (PubChem CID 71537688) has the molecular formula C18H22F3NO4 and a molecular weight of 373.37 g/mol. Its IUPAC name is diethyl (2S,3R,4R)-1-benzyl-2-(trifluoromethyl)pyrrolidine-3,4-dicarboxylate.
| Compound Name | diethyl (2S,3R,4R)-1-benzyl-2-(trifluoromethyl)pyrrolidine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 71537688 |
| Molecular Formula | C18H22F3NO4 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | diethyl (2S,3R,4R)-1-benzyl-2-(trifluoromethyl)pyrrolidine-3,4-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](C(=O)OCC)CN(Cc2ccccc2)[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C18H22F3NO4/c1-3-25-16(23)13-11-22(10-12-8-6-5-7-9-12)15(18(19,20)21)14(13)17(24)26-4-2/h5-9,13-15H,3-4,10-11H2,1-2H3/t13-,14+,15-/m0/s1 |
| InChIKey | PFJZUDFUNZWNEG-ZNMIVQPWSA-N |
| XLogP | 2.79 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |