C19H20O7 — CID 71537873
(3E,3aS,4S,8bS)-4-hydroxy-8,8-dimethyl-3-[[(2R)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-4,5,6,8b-tetrahydro-3aH-indeno[1,2-b]furan-2,7-dione (PubChem CID 71537873) has the molecular formula C19H20O7 and a molecular weight of 360.36 g/mol. Its IUPAC name is (3E,3aS,4S,8bS)-4-hydroxy-8,8-dimethyl-3-[[(2R)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-4,5,6,8b-tetrahydro-3aH-indeno[1,2-b]furan-2,7-dione.
| Compound Name | (3E,3aS,4S,8bS)-4-hydroxy-8,8-dimethyl-3-[[(2R)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-4,5,6,8b-tetrahydro-3aH-indeno[1,2-b]furan-2,7-dione |
|---|---|
| PubChem CID | 71537873 |
| Molecular Formula | C19H20O7 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (3E,3aS,4S,8bS)-4-hydroxy-8,8-dimethyl-3-[[(2R)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-4,5,6,8b-tetrahydro-3aH-indeno[1,2-b]furan-2,7-dione |
| SMILES | CC1=C[C@H](O/C=C2/C(=O)O[C@@H]3C4=C(CCC(=O)C4(C)C)[C@@H](O)[C@H]23)OC1=O |
| InChI | InChI=1S/C19H20O7/c1-8-6-12(25-17(8)22)24-7-10-13-15(21)9-4-5-11(20)19(2,3)14(9)16(13)26-18(10)23/h6-7,12-13,15-16,21H,4-5H2,1-3H3/b10-7+/t12-,13+,15-,16+/m1/s1 |
| InChIKey | CHKDOMXJQUEQLN-AORPGMBKSA-N |
| XLogP | 1.32 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|