About 3-(5-fluoro-1-benzofuran-2-yl)-6-(3-methylsulfonylpropoxy)imidazo[1,2-b]pyridazine
3-(5-fluoro-1-benzofuran-2-yl)-6-(3-methylsulfonylpropoxy)imidazo[1,2-b]pyridazine (PubChem CID 71538384) has the molecular formula C18H16FN3O4S
and a molecular weight of 389.41 g/mol. Its IUPAC name is 3-(5-fluoro-1-benzofuran-2-yl)-6-(3-methylsulfonylpropoxy)imidazo[1,2-b]pyridazine.
Molecular Properties
| Compound Name | 3-(5-fluoro-1-benzofuran-2-yl)-6-(3-methylsulfonylpropoxy)imidazo[1,2-b]pyridazine |
| PubChem CID | 71538384 |
| Molecular Formula | C18H16FN3O4S |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 3-(5-fluoro-1-benzofuran-2-yl)-6-(3-methylsulfonylpropoxy)imidazo[1,2-b]pyridazine |
| SMILES | CS(=O)(=O)CCCOc1ccc2ncc(-c3cc4cc(F)ccc4o3)n2n1 |
| InChI | InChI=1S/C18H16FN3O4S/c1-27(23,24)8-2-7-25-18-6-5-17-20-11-14(22(17)21-18)16-10-12-9-13(19)3-4-15(12)26-16/h3-6,9-11H,2,7-8H2,1H3 |
| InChIKey | LTWXWWRYQNDMAK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 86.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-fluoro-1-benzofuran-2-yl)-6-(3-methylsulfonylpropoxy)imidazo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-fluoro-1-benzofuran-2-yl)-6-(3-methylsulfonylpropoxy)imidazo[1,2-b]pyridazine?
The IUPAC name of 3-(5-fluoro-1-benzofuran-2-yl)-6-(3-methylsulfonylpropoxy)imidazo[1,2-b]pyridazine (CID 71538384) is 3-(5-fluoro-1-benzofuran-2-yl)-6-(3-methylsulfonylpropoxy)imidazo[1,2-b]pyridazine.
What is the SMILES notation for 3-(5-fluoro-1-benzofuran-2-yl)-6-(3-methylsulfonylpropoxy)imidazo[1,2-b]pyridazine?
The canonical SMILES for 3-(5-fluoro-1-benzofuran-2-yl)-6-(3-methylsulfonylpropoxy)imidazo[1,2-b]pyridazine is CS(=O)(=O)CCCOc1ccc2ncc(-c3cc4cc(F)ccc4o3)n2n1.
What is the InChIKey of 3-(5-fluoro-1-benzofuran-2-yl)-6-(3-methylsulfonylpropoxy)imidazo[1,2-b]pyridazine?
The InChIKey is LTWXWWRYQNDMAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16FN3O4S/c1-27(23,24)8-2-7-25-18-6-5-17-20-11-14(22(17)21-18)16-10-12-9-13(19)3-4-15(12)26-16/h3-6,9-11H,2,7-8H2,1H3.
What are the key properties of 3-(5-fluoro-1-benzofuran-2-yl)-6-(3-methylsulfonylpropoxy)imidazo[1,2-b]pyridazine?
3-(5-fluoro-1-benzofuran-2-yl)-6-(3-methylsulfonylpropoxy)imidazo[1,2-b]pyridazine has a molecular weight of 389.41 g/mol, XLogP of 3.10, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-fluoro-1-benzofuran-2-yl)-6-(3-methylsulfonylpropoxy)imidazo[1,2-b]pyridazine is sourced from PubChem (CID 71538384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).