C17H11ClF2N6O2S — CID 71538952
N-[4-(3-amino-2H-pyrazolo[3,4-b]pyrazin-6-yl)phenyl]-5-chloro-2,4-difluorobenzenesulfonamide (PubChem CID 71538952) has the molecular formula C17H11ClF2N6O2S and a molecular weight of 436.83 g/mol. Its IUPAC name is N-[4-(3-amino-2H-pyrazolo[3,4-b]pyrazin-6-yl)phenyl]-5-chloro-2,4-difluorobenzenesulfonamide.
| Compound Name | N-[4-(3-amino-2H-pyrazolo[3,4-b]pyrazin-6-yl)phenyl]-5-chloro-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 71538952 |
| Molecular Formula | C17H11ClF2N6O2S |
| Molecular Weight | 436.83 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | N-[4-(3-amino-2H-pyrazolo[3,4-b]pyrazin-6-yl)phenyl]-5-chloro-2,4-difluorobenzenesulfonamide |
| SMILES | Nc1[nH]nc2nc(-c3ccc(NS(=O)(=O)c4cc(Cl)c(F)cc4F)cc3)cnc12 |
| InChI | InChI=1S/C17H11ClF2N6O2S/c18-10-5-14(12(20)6-11(10)19)29(27,28)26-9-3-1-8(2-4-9)13-7-22-15-16(21)24-25-17(15)23-13/h1-7,26H,(H3,21,23,24,25) |
| InChIKey | KVTVEIFPLGJOJG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.83 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|