About 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxyphenyl]acetate
2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxyphenyl]acetate (PubChem CID 71539069) has the molecular formula C18H24F3NO5
and a molecular weight of 391.39 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxyphenyl]acetate.
Molecular Properties
| Compound Name | 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxyphenyl]acetate |
| PubChem CID | 71539069 |
| Molecular Formula | C18H24F3NO5 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxyphenyl]acetate |
| SMILES | CCOc1cc(CC(=O)OCC(F)(F)F)ccc1OCC(=O)N(CC)CC |
| InChI | InChI=1S/C18H24F3NO5/c1-4-22(5-2)16(23)11-26-14-8-7-13(9-15(14)25-6-3)10-17(24)27-12-18(19,20)21/h7-9H,4-6,10-12H2,1-3H3 |
| InChIKey | XPEVFXWYLDXVJS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxyphenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxyphenyl]acetate?
The IUPAC name of 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxyphenyl]acetate (CID 71539069) is 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxyphenyl]acetate.
What is the SMILES notation for 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxyphenyl]acetate?
The canonical SMILES for 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxyphenyl]acetate is CCOc1cc(CC(=O)OCC(F)(F)F)ccc1OCC(=O)N(CC)CC.
What is the InChIKey of 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxyphenyl]acetate?
The InChIKey is XPEVFXWYLDXVJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24F3NO5/c1-4-22(5-2)16(23)11-26-14-8-7-13(9-15(14)25-6-3)10-17(24)27-12-18(19,20)21/h7-9H,4-6,10-12H2,1-3H3.
What are the key properties of 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxyphenyl]acetate?
2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxyphenyl]acetate has a molecular weight of 391.39 g/mol, XLogP of 2.98, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxyphenyl]acetate is sourced from PubChem (CID 71539069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).