C39H48N4O2 — CID 71539470
1-methyl-9-[9-(1-methyl-7-propan-2-yloxypyrido[3,4-b]indol-9-yl)nonyl]-7-propan-2-yloxypyrido[3,4-b]indole (PubChem CID 71539470) has the molecular formula C39H48N4O2 and a molecular weight of 604.84 g/mol. Its IUPAC name is 1-methyl-9-[9-(1-methyl-7-propan-2-yloxypyrido[3,4-b]indol-9-yl)nonyl]-7-propan-2-yloxypyrido[3,4-b]indole.
| Compound Name | 1-methyl-9-[9-(1-methyl-7-propan-2-yloxypyrido[3,4-b]indol-9-yl)nonyl]-7-propan-2-yloxypyrido[3,4-b]indole |
|---|---|
| PubChem CID | 71539470 |
| Molecular Formula | C39H48N4O2 |
| Molecular Weight | 604.84 g/mol |
| Exact Mass | 604.38 |
| IUPAC Name | 1-methyl-9-[9-(1-methyl-7-propan-2-yloxypyrido[3,4-b]indol-9-yl)nonyl]-7-propan-2-yloxypyrido[3,4-b]indole |
| SMILES | Cc1nccc2c3ccc(OC(C)C)cc3n(CCCCCCCCCn3c4cc(OC(C)C)ccc4c4ccnc(C)c43)c12 |
| InChI | InChI=1S/C39H48N4O2/c1-26(2)44-30-14-16-32-34-18-20-40-28(5)38(34)42(36(32)24-30)22-12-10-8-7-9-11-13-23-43-37-25-31(45-27(3)4)15-17-33(37)35-19-21-41-29(6)39(35)43/h14-21,24-27H,7-13,22-23H2,1-6H3 |
| InChIKey | CSGRYDPLIQEICA-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.84 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|