C18H11FN4O4S2 — CID 71539506
3-(1,3-benzodioxol-5-ylmethylsulfanyl)-5-(4-fluoro-2-nitrophenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazole (PubChem CID 71539506) has the molecular formula C18H11FN4O4S2 and a molecular weight of 430.44 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethylsulfanyl)-5-(4-fluoro-2-nitrophenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazole.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethylsulfanyl)-5-(4-fluoro-2-nitrophenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazole |
|---|---|
| PubChem CID | 71539506 |
| Molecular Formula | C18H11FN4O4S2 |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethylsulfanyl)-5-(4-fluoro-2-nitrophenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazole |
| SMILES | O=[N+]([O-])c1cc(F)ccc1-c1csc2nnc(SCc3ccc4c(c3)OCO4)n12 |
| InChI | InChI=1S/C18H11FN4O4S2/c19-11-2-3-12(13(6-11)23(24)25)14-8-29-18-21-20-17(22(14)18)28-7-10-1-4-15-16(5-10)27-9-26-15/h1-6,8H,7,9H2 |
| InChIKey | GYUFXBPCFMYGDW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|