C36H38N4O4 — CID 71539631
ethyl 9-[6-(3-ethoxycarbonyl-1-methylpyrido[3,4-b]indol-9-yl)hexyl]-1-methylpyrido[3,4-b]indole-3-carboxylate (PubChem CID 71539631) has the molecular formula C36H38N4O4 and a molecular weight of 590.72 g/mol. Its IUPAC name is ethyl 9-[6-(3-ethoxycarbonyl-1-methylpyrido[3,4-b]indol-9-yl)hexyl]-1-methylpyrido[3,4-b]indole-3-carboxylate.
| Compound Name | ethyl 9-[6-(3-ethoxycarbonyl-1-methylpyrido[3,4-b]indol-9-yl)hexyl]-1-methylpyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 71539631 |
| Molecular Formula | C36H38N4O4 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.29 |
| IUPAC Name | ethyl 9-[6-(3-ethoxycarbonyl-1-methylpyrido[3,4-b]indol-9-yl)hexyl]-1-methylpyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCOC(=O)c1cc2c3ccccc3n(CCCCCCn3c4ccccc4c4cc(C(=O)OCC)nc(C)c43)c2c(C)n1 |
| InChI | InChI=1S/C36H38N4O4/c1-5-43-35(41)29-21-27-25-15-9-11-17-31(25)39(33(27)23(3)37-29)19-13-7-8-14-20-40-32-18-12-10-16-26(32)28-22-30(36(42)44-6-2)38-24(4)34(28)40/h9-12,15-18,21-22H,5-8,13-14,19-20H2,1-4H3 |
| InChIKey | FANDYKZRDRZQFI-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|