C46H46N4O6 — CID 71539633
1-(3,4,5-trimethoxyphenyl)-9-[6-[1-(3,4,5-trimethoxyphenyl)pyrido[3,4-b]indol-9-yl]hexyl]pyrido[3,4-b]indole (PubChem CID 71539633) has the molecular formula C46H46N4O6 and a molecular weight of 750.90 g/mol. Its IUPAC name is 1-(3,4,5-trimethoxyphenyl)-9-[6-[1-(3,4,5-trimethoxyphenyl)pyrido[3,4-b]indol-9-yl]hexyl]pyrido[3,4-b]indole.
| Compound Name | 1-(3,4,5-trimethoxyphenyl)-9-[6-[1-(3,4,5-trimethoxyphenyl)pyrido[3,4-b]indol-9-yl]hexyl]pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 71539633 |
| Molecular Formula | C46H46N4O6 |
| Molecular Weight | 750.90 g/mol |
| Exact Mass | 750.34 |
| IUPAC Name | 1-(3,4,5-trimethoxyphenyl)-9-[6-[1-(3,4,5-trimethoxyphenyl)pyrido[3,4-b]indol-9-yl]hexyl]pyrido[3,4-b]indole |
| SMILES | COc1cc(-c2nccc3c4ccccc4n(CCCCCCn4c5ccccc5c5ccnc(-c6cc(OC)c(OC)c(OC)c6)c54)c23)cc(OC)c1OC |
| InChI | InChI=1S/C46H46N4O6/c1-51-37-25-29(26-38(52-2)45(37)55-5)41-43-33(19-21-47-41)31-15-9-11-17-35(31)49(43)23-13-7-8-14-24-50-36-18-12-10-16-32(36)34-20-22-48-42(44(34)50)30-27-39(53-3)46(56-6)40(28-30)54-4/h9-12,15-22,25-28H,7-8,13-14,23-24H2,1-6H3 |
| InChIKey | DBYAGHVLTYDLEA-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 91.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.90 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|