C47H48N4O6 — CID 71539687
1-(3,4,5-trimethoxyphenyl)-9-[7-[1-(3,4,5-trimethoxyphenyl)pyrido[3,4-b]indol-9-yl]heptyl]pyrido[3,4-b]indole (PubChem CID 71539687) has the molecular formula C47H48N4O6 and a molecular weight of 764.92 g/mol. Its IUPAC name is 1-(3,4,5-trimethoxyphenyl)-9-[7-[1-(3,4,5-trimethoxyphenyl)pyrido[3,4-b]indol-9-yl]heptyl]pyrido[3,4-b]indole.
| Compound Name | 1-(3,4,5-trimethoxyphenyl)-9-[7-[1-(3,4,5-trimethoxyphenyl)pyrido[3,4-b]indol-9-yl]heptyl]pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 71539687 |
| Molecular Formula | C47H48N4O6 |
| Molecular Weight | 764.92 g/mol |
| Exact Mass | 764.36 |
| IUPAC Name | 1-(3,4,5-trimethoxyphenyl)-9-[7-[1-(3,4,5-trimethoxyphenyl)pyrido[3,4-b]indol-9-yl]heptyl]pyrido[3,4-b]indole |
| SMILES | COc1cc(-c2nccc3c4ccccc4n(CCCCCCCn4c5ccccc5c5ccnc(-c6cc(OC)c(OC)c(OC)c6)c54)c23)cc(OC)c1OC |
| InChI | InChI=1S/C47H48N4O6/c1-52-38-26-30(27-39(53-2)46(38)56-5)42-44-34(20-22-48-42)32-16-10-12-18-36(32)50(44)24-14-8-7-9-15-25-51-37-19-13-11-17-33(37)35-21-23-49-43(45(35)51)31-28-40(54-3)47(57-6)41(29-31)55-4/h10-13,16-23,26-29H,7-9,14-15,24-25H2,1-6H3 |
| InChIKey | DWBOGJSCEPBMKX-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 91.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.92 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|