About 5-ethyl-7-(3-morpholin-4-ylphenyl)-1H-pyrazolo[4,5-c]quinolin-4-one
5-ethyl-7-(3-morpholin-4-ylphenyl)-1H-pyrazolo[4,5-c]quinolin-4-one (PubChem CID 71539753) has the molecular formula C22H22N4O2
and a molecular weight of 374.44 g/mol. Its IUPAC name is 5-ethyl-7-(3-morpholin-4-ylphenyl)-1H-pyrazolo[4,5-c]quinolin-4-one.
Molecular Properties
| Compound Name | 5-ethyl-7-(3-morpholin-4-ylphenyl)-1H-pyrazolo[4,5-c]quinolin-4-one |
| PubChem CID | 71539753 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 5-ethyl-7-(3-morpholin-4-ylphenyl)-1H-pyrazolo[4,5-c]quinolin-4-one |
| SMILES | CCn1c(=O)c2cn[nH]c2c2ccc(-c3cccc(N4CCOCC4)c3)cc21 |
| InChI | InChI=1S/C22H22N4O2/c1-2-26-20-13-16(6-7-18(20)21-19(22(26)27)14-23-24-21)15-4-3-5-17(12-15)25-8-10-28-11-9-25/h3-7,12-14H,2,8-11H2,1H3,(H,23,24) |
| InChIKey | LDJCNHAJXUXURM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 63.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-ethyl-7-(3-morpholin-4-ylphenyl)-1H-pyrazolo[4,5-c]quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-7-(3-morpholin-4-ylphenyl)-1H-pyrazolo[4,5-c]quinolin-4-one?
The IUPAC name of 5-ethyl-7-(3-morpholin-4-ylphenyl)-1H-pyrazolo[4,5-c]quinolin-4-one (CID 71539753) is 5-ethyl-7-(3-morpholin-4-ylphenyl)-1H-pyrazolo[4,5-c]quinolin-4-one.
What is the SMILES notation for 5-ethyl-7-(3-morpholin-4-ylphenyl)-1H-pyrazolo[4,5-c]quinolin-4-one?
The canonical SMILES for 5-ethyl-7-(3-morpholin-4-ylphenyl)-1H-pyrazolo[4,5-c]quinolin-4-one is CCn1c(=O)c2cn[nH]c2c2ccc(-c3cccc(N4CCOCC4)c3)cc21.
What is the InChIKey of 5-ethyl-7-(3-morpholin-4-ylphenyl)-1H-pyrazolo[4,5-c]quinolin-4-one?
The InChIKey is LDJCNHAJXUXURM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N4O2/c1-2-26-20-13-16(6-7-18(20)21-19(22(26)27)14-23-24-21)15-4-3-5-17(12-15)25-8-10-28-11-9-25/h3-7,12-14H,2,8-11H2,1H3,(H,23,24).
What are the key properties of 5-ethyl-7-(3-morpholin-4-ylphenyl)-1H-pyrazolo[4,5-c]quinolin-4-one?
5-ethyl-7-(3-morpholin-4-ylphenyl)-1H-pyrazolo[4,5-c]quinolin-4-one has a molecular weight of 374.44 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-7-(3-morpholin-4-ylphenyl)-1H-pyrazolo[4,5-c]quinolin-4-one is sourced from PubChem (CID 71539753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).