About 1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-3,4-dihydroquinolin-2-one
1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-3,4-dihydroquinolin-2-one (PubChem CID 71540385) has the molecular formula C20H18FN3O
and a molecular weight of 335.38 g/mol. Its IUPAC name is 1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-3,4-dihydroquinolin-2-one.
Molecular Properties
| Compound Name | 1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-3,4-dihydroquinolin-2-one |
| PubChem CID | 71540385 |
| Molecular Formula | C20H18FN3O |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-3,4-dihydroquinolin-2-one |
| SMILES | Cn1cc(-c2ccc(CN3C(=O)CCc4ccccc43)c(F)c2)cn1 |
| InChI | InChI=1S/C20H18FN3O/c1-23-12-17(11-22-23)15-6-7-16(18(21)10-15)13-24-19-5-3-2-4-14(19)8-9-20(24)25/h2-7,10-12H,8-9,13H2,1H3 |
| InChIKey | MPCPECLKVIQFTG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-3,4-dihydroquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-3,4-dihydroquinolin-2-one?
The IUPAC name of 1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-3,4-dihydroquinolin-2-one (CID 71540385) is 1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-3,4-dihydroquinolin-2-one.
What is the SMILES notation for 1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-3,4-dihydroquinolin-2-one?
The canonical SMILES for 1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-3,4-dihydroquinolin-2-one is Cn1cc(-c2ccc(CN3C(=O)CCc4ccccc43)c(F)c2)cn1.
What is the InChIKey of 1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-3,4-dihydroquinolin-2-one?
The InChIKey is MPCPECLKVIQFTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18FN3O/c1-23-12-17(11-22-23)15-6-7-16(18(21)10-15)13-24-19-5-3-2-4-14(19)8-9-20(24)25/h2-7,10-12H,8-9,13H2,1H3.
What are the key properties of 1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-3,4-dihydroquinolin-2-one?
1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-3,4-dihydroquinolin-2-one has a molecular weight of 335.38 g/mol, XLogP of 3.71, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-3,4-dihydroquinolin-2-one is sourced from PubChem (CID 71540385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).