About 4-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-2,3-dihydro-1,4-benzothiazine
4-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-2,3-dihydro-1,4-benzothiazine (PubChem CID 71540496) has the molecular formula C19H18FN3S
and a molecular weight of 339.44 g/mol. Its IUPAC name is 4-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-2,3-dihydro-1,4-benzothiazine.
Molecular Properties
| Compound Name | 4-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-2,3-dihydro-1,4-benzothiazine |
| PubChem CID | 71540496 |
| Molecular Formula | C19H18FN3S |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 4-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-2,3-dihydro-1,4-benzothiazine |
| SMILES | Cn1cc(-c2ccc(CN3CCSc4ccccc43)c(F)c2)cn1 |
| InChI | InChI=1S/C19H18FN3S/c1-22-12-16(11-21-22)14-6-7-15(17(20)10-14)13-23-8-9-24-19-5-3-2-4-18(19)23/h2-7,10-12H,8-9,13H2,1H3 |
| InChIKey | WKPOXPGXSHOAFD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-2,3-dihydro-1,4-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-2,3-dihydro-1,4-benzothiazine?
The IUPAC name of 4-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-2,3-dihydro-1,4-benzothiazine (CID 71540496) is 4-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-2,3-dihydro-1,4-benzothiazine.
What is the SMILES notation for 4-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-2,3-dihydro-1,4-benzothiazine?
The canonical SMILES for 4-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-2,3-dihydro-1,4-benzothiazine is Cn1cc(-c2ccc(CN3CCSc4ccccc43)c(F)c2)cn1.
What is the InChIKey of 4-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-2,3-dihydro-1,4-benzothiazine?
The InChIKey is WKPOXPGXSHOAFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18FN3S/c1-22-12-16(11-21-22)14-6-7-15(17(20)10-14)13-23-8-9-24-19-5-3-2-4-18(19)23/h2-7,10-12H,8-9,13H2,1H3.
What are the key properties of 4-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-2,3-dihydro-1,4-benzothiazine?
4-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-2,3-dihydro-1,4-benzothiazine has a molecular weight of 339.44 g/mol, XLogP of 4.34, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-2,3-dihydro-1,4-benzothiazine is sourced from PubChem (CID 71540496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).