C19H38O3Si — CID 71540880
methyl (E,4R,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylnon-2-enoate (PubChem CID 71540880) has the molecular formula C19H38O3Si and a molecular weight of 342.60 g/mol. Its IUPAC name is methyl (E,4R,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylnon-2-enoate.
| Compound Name | methyl (E,4R,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylnon-2-enoate |
|---|---|
| PubChem CID | 71540880 |
| Molecular Formula | C19H38O3Si |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | methyl (E,4R,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylnon-2-enoate |
| SMILES | CCC[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C(\C)C(=O)OC |
| InChI | InChI=1S/C19H38O3Si/c1-11-12-14(2)17(22-23(9,10)19(5,6)7)15(3)13-16(4)18(20)21-8/h13-15,17H,11-12H2,1-10H3/b16-13+/t14-,15-,17+/m1/s1 |
| InChIKey | NGXCMEMQADTBNM-XHVRNXTLSA-N |
| XLogP | 5.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|