C14H17Cl2NO — CID 71541096
2-[(3R)-3-(3,4-dichlorophenyl)-2,3,4,7-tetrahydroazepin-1-yl]ethanol (PubChem CID 71541096) has the molecular formula C14H17Cl2NO and a molecular weight of 286.20 g/mol. Its IUPAC name is 2-[(3R)-3-(3,4-dichlorophenyl)-2,3,4,7-tetrahydroazepin-1-yl]ethanol.
| Compound Name | 2-[(3R)-3-(3,4-dichlorophenyl)-2,3,4,7-tetrahydroazepin-1-yl]ethanol |
|---|---|
| PubChem CID | 71541096 |
| Molecular Formula | C14H17Cl2NO |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2-[(3R)-3-(3,4-dichlorophenyl)-2,3,4,7-tetrahydroazepin-1-yl]ethanol |
| SMILES | OCCN1CC=CC[C@H](c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C14H17Cl2NO/c15-13-5-4-11(9-14(13)16)12-3-1-2-6-17(10-12)7-8-18/h1-2,4-5,9,12,18H,3,6-8,10H2/t12-/m0/s1 |
| InChIKey | ODFLDWCDMOARBM-LBPRGKRZSA-N |
| XLogP | 3.33 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|