C15H19Cl2NO — CID 71541097
(3R)-3-(3,4-dichlorophenyl)-1-(2-methoxyethyl)-2,3,4,7-tetrahydroazepine (PubChem CID 71541097) has the molecular formula C15H19Cl2NO and a molecular weight of 300.23 g/mol. Its IUPAC name is (3R)-3-(3,4-dichlorophenyl)-1-(2-methoxyethyl)-2,3,4,7-tetrahydroazepine.
| Compound Name | (3R)-3-(3,4-dichlorophenyl)-1-(2-methoxyethyl)-2,3,4,7-tetrahydroazepine |
|---|---|
| PubChem CID | 71541097 |
| Molecular Formula | C15H19Cl2NO |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | (3R)-3-(3,4-dichlorophenyl)-1-(2-methoxyethyl)-2,3,4,7-tetrahydroazepine |
| SMILES | COCCN1CC=CC[C@H](c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C15H19Cl2NO/c1-19-9-8-18-7-3-2-4-13(11-18)12-5-6-14(16)15(17)10-12/h2-3,5-6,10,13H,4,7-9,11H2,1H3/t13-/m0/s1 |
| InChIKey | RZPGXWQFZWSYES-ZDUSSCGKSA-N |
| XLogP | 3.99 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|