C21H24N4OS — CID 71541178
3-[(2-amino-5,6,8,9-tetrahydro-[1,3]thiazolo[4,5-h][3]benzazepin-7-yl)methyl]-N,N-dimethylbenzamide (PubChem CID 71541178) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is 3-[(2-amino-5,6,8,9-tetrahydro-[1,3]thiazolo[4,5-h][3]benzazepin-7-yl)methyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[(2-amino-5,6,8,9-tetrahydro-[1,3]thiazolo[4,5-h][3]benzazepin-7-yl)methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 71541178 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 3-[(2-amino-5,6,8,9-tetrahydro-[1,3]thiazolo[4,5-h][3]benzazepin-7-yl)methyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(CN2CCc3cc4nc(N)sc4cc3CC2)c1 |
| InChI | InChI=1S/C21H24N4OS/c1-24(2)20(26)17-5-3-4-14(10-17)13-25-8-6-15-11-18-19(27-21(22)23-18)12-16(15)7-9-25/h3-5,10-12H,6-9,13H2,1-2H3,(H2,22,23) |
| InChIKey | QYXHDXVSRFUNRT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |