C15H17NO — CID 71541188
3-(1-benzofuran-2-yl)-1-methyl-2,3,4,7-tetrahydroazepine (PubChem CID 71541188) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is 3-(1-benzofuran-2-yl)-1-methyl-2,3,4,7-tetrahydroazepine.
| Compound Name | 3-(1-benzofuran-2-yl)-1-methyl-2,3,4,7-tetrahydroazepine |
|---|---|
| PubChem CID | 71541188 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 3-(1-benzofuran-2-yl)-1-methyl-2,3,4,7-tetrahydroazepine |
| SMILES | CN1CC=CCC(c2cc3ccccc3o2)C1 |
| InChI | InChI=1S/C15H17NO/c1-16-9-5-4-7-13(11-16)15-10-12-6-2-3-8-14(12)17-15/h2-6,8,10,13H,7,9,11H2,1H3 |
| InChIKey | LBMMBEDCUJAMIZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|