C13H16ClN — CID 71541193
3-(3-chloro-4-methylphenyl)-2,3,4,7-tetrahydro-1H-azepine (PubChem CID 71541193) has the molecular formula C13H16ClN and a molecular weight of 221.73 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-2,3,4,7-tetrahydro-1H-azepine.
| Compound Name | 3-(3-chloro-4-methylphenyl)-2,3,4,7-tetrahydro-1H-azepine |
|---|---|
| PubChem CID | 71541193 |
| Molecular Formula | C13H16ClN |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-2,3,4,7-tetrahydro-1H-azepine |
| SMILES | Cc1ccc(C2CC=CCNC2)cc1Cl |
| InChI | InChI=1S/C13H16ClN/c1-10-5-6-11(8-13(10)14)12-4-2-3-7-15-9-12/h2-3,5-6,8,12,15H,4,7,9H2,1H3 |
| InChIKey | YSGVIJFMBOEZJZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|