C38H33N3O6 — CID 71541219
6-(3-imidazol-1-ylpropyl)-2,3-dimethoxy-8,9-bis(phenylmethoxy)indeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 71541219) has the molecular formula C38H33N3O6 and a molecular weight of 627.70 g/mol. Its IUPAC name is 6-(3-imidazol-1-ylpropyl)-2,3-dimethoxy-8,9-bis(phenylmethoxy)indeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 6-(3-imidazol-1-ylpropyl)-2,3-dimethoxy-8,9-bis(phenylmethoxy)indeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 71541219 |
| Molecular Formula | C38H33N3O6 |
| Molecular Weight | 627.70 g/mol |
| Exact Mass | 627.24 |
| IUPAC Name | 6-(3-imidazol-1-ylpropyl)-2,3-dimethoxy-8,9-bis(phenylmethoxy)indeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | COc1cc2c3c(n(CCCn4ccnc4)c(=O)c2cc1OC)-c1cc(OCc2ccccc2)c(OCc2ccccc2)cc1C3=O |
| InChI | InChI=1S/C38H33N3O6/c1-44-31-18-27-30(21-32(31)45-2)38(43)41(16-9-15-40-17-14-39-24-40)36-28-19-33(46-22-25-10-5-3-6-11-25)34(20-29(28)37(42)35(27)36)47-23-26-12-7-4-8-13-26/h3-8,10-14,17-21,24H,9,15-16,22-23H2,1-2H3 |
| InChIKey | OSLVUTRZLZZPDO-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 93.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.70 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|